|
|
|
|
A New Heterogeneous Nanocatalyst for Sulfoxidation of Sulfids to Corresponding Adrafinil Analogous: Synthesis, Properties and Applications of VO3-/NH3+-SiO2/Fe3O4
|
|
|
|
|
|
|
|
نویسنده
|
Taghizadeh M.J. ,Javidan A. ,Hosseinchi O.
|
|
منبع
|
journal of sciences islamic republic of iran - 2015 - دوره : 26 - شماره : 2 - صفحه:125 -130
|
|
چکیده
|
A new magnetic nanocatalyst has been prepared using immobilization of vanadate onto aminopropyl functionalized sio2/fe3o4(vo3-/nh3+-sio2/fe3o4). the obtained magnetic catalyst was characterized by ft-ir, xrd, vsm and sem techniques and used for sulfoxidation of sulfide compounds to the correspondingsulfoxides in presence of h2o2 as oxidant at room temperature. the optimum of reaction conditions and reusability of catalyst have been investigated.
|
|
کلیدواژه
|
Sulfoxidation ,Fe3O4 nanoparticles ,SiO2/Fe3O4 nanoparticles ,Adrafinil analogues
|
|
آدرس
|
Department of Chemistry, Faculty of Sciences, University of Imam Hossein, Tehran, Islamic Republic of Iran, ایران, Department of Chemistry, Faculty of Sciences, University of Imam Hossein, Tehran, Islamic Republic of Iran, ایران, iran university of science and technology, ایران
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Authors
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|